C14H23N4O3+ — CID 7477694
1-(2,4-dimethoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)urea (PubChem CID 7477694) has the molecular formula C14H23N4O3+ and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)urea |
|---|---|
| PubChem CID | 7477694 |
| Molecular Formula | C14H23N4O3+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)urea |
| SMILES | COc1ccc(NC(=O)NN2CC[NH+](C)CC2)c(OC)c1 |
| InChI | InChI=1S/C14H22N4O3/c1-17-6-8-18(9-7-17)16-14(19)15-12-5-4-11(20-2)10-13(12)21-3/h4-5,10H,6-9H2,1-3H3,(H2,15,16,19)/p+1 |
| InChIKey | LIKGBLIGWAQXIG-UHFFFAOYSA-O |
| XLogP | -0.43 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |