C14H23N4O2S+ — CID 4743611
1-(2,4-dimethoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)thiourea (PubChem CID 4743611) has the molecular formula C14H23N4O2S+ and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)thiourea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)thiourea |
|---|---|
| PubChem CID | 4743611 |
| Molecular Formula | C14H23N4O2S+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)thiourea |
| SMILES | COc1ccc(NC(=S)NN2CC[NH+](C)CC2)c(OC)c1 |
| InChI | InChI=1S/C14H22N4O2S/c1-17-6-8-18(9-7-17)16-14(21)15-12-5-4-11(19-2)10-13(12)20-3/h4-5,10H,6-9H2,1-3H3,(H2,15,16,21)/p+1 |
| InChIKey | ZCGYBUWWMLEDSV-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 50.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|