C13H14N2O4S — CID 134121134
N-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidine-1-carbothioamide (PubChem CID 134121134) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidine-1-carbothioamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 134121134 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2,5-dioxopyrrolidine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2C(=O)CCC2=O)c(OC)c1 |
| InChI | InChI=1S/C13H14N2O4S/c1-18-8-3-4-9(10(7-8)19-2)14-13(20)15-11(16)5-6-12(15)17/h3-4,7H,5-6H2,1-2H3,(H,14,20) |
| InChIKey | QPJKAFLTWCZDGV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|