C12H18ClN4S+ — CID 7318966
1-(4-chlorophenyl)-3-(4-methylpiperazin-4-ium-1-yl)thiourea (PubChem CID 7318966) has the molecular formula C12H18ClN4S+ and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-methylpiperazin-4-ium-1-yl)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(4-methylpiperazin-4-ium-1-yl)thiourea |
|---|---|
| PubChem CID | 7318966 |
| Molecular Formula | C12H18ClN4S+ |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-methylpiperazin-4-ium-1-yl)thiourea |
| SMILES | C[NH+]1CCN(NC(=S)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C12H17ClN4S/c1-16-6-8-17(9-7-16)15-12(18)14-11-4-2-10(13)3-5-11/h2-5H,6-9H2,1H3,(H2,14,15,18)/p+1 |
| InChIKey | OOBHBXREVQFFTJ-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 31.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|