C13H18Cl2N3O+ — CID 9204698
2-(2,4-dichlorophenyl)-N-(4-methylpiperazin-4-ium-1-yl)acetamide (PubChem CID 9204698) has the molecular formula C13H18Cl2N3O+ and a molecular weight of 303.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(4-methylpiperazin-4-ium-1-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(4-methylpiperazin-4-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 9204698 |
| Molecular Formula | C13H18Cl2N3O+ |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(4-methylpiperazin-4-ium-1-yl)acetamide |
| SMILES | C[NH+]1CCN(NC(=O)Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C13H17Cl2N3O/c1-17-4-6-18(7-5-17)16-13(19)8-10-2-3-11(14)9-12(10)15/h2-3,9H,4-8H2,1H3,(H,16,19)/p+1 |
| InChIKey | XKJFDOAYDALPDX-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |