C11H13Cl2NO2 — CID 43418876
2-(2,4-dichlorophenyl)-N-(1-hydroxypropan-2-yl)acetamide (PubChem CID 43418876) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(1-hydroxypropan-2-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(1-hydroxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 43418876 |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(1-hydroxypropan-2-yl)acetamide |
| SMILES | CC(CO)NC(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NO2/c1-7(6-15)14-11(16)4-8-2-3-9(12)5-10(8)13/h2-3,5,7,15H,4,6H2,1H3,(H,14,16) |
| InChIKey | SNEKIYLNKHDTFU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |