C13H20ClN4O2+ — CID 7470131
1-(5-chloro-2-methoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)urea (PubChem CID 7470131) has the molecular formula C13H20ClN4O2+ and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)urea |
|---|---|
| PubChem CID | 7470131 |
| Molecular Formula | C13H20ClN4O2+ |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-methylpiperazin-4-ium-1-yl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NN1CC[NH+](C)CC1 |
| InChI | InChI=1S/C13H19ClN4O2/c1-17-5-7-18(8-6-17)16-13(19)15-11-9-10(14)3-4-12(11)20-2/h3-4,9H,5-8H2,1-2H3,(H2,15,16,19)/p+1 |
| InChIKey | GGLUGQLEFKUKBV-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |