C15H21ClN3O3+ — CID 2101557
2-(4-acetylpiperazin-1-ium-1-yl)-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 2101557) has the molecular formula C15H21ClN3O3+ and a molecular weight of 326.80 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-ium-1-yl)-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-(4-acetylpiperazin-1-ium-1-yl)-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2101557 |
| Molecular Formula | C15H21ClN3O3+ |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(4-acetylpiperazin-1-ium-1-yl)-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C[NH+]1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-11(20)19-7-5-18(6-8-19)10-15(21)17-13-9-12(16)3-4-14(13)22-2/h3-4,9H,5-8,10H2,1-2H3,(H,17,21)/p+1 |
| InChIKey | HJYQTQZNCHNZQH-UHFFFAOYSA-O |
| XLogP | 0.03 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |