C14H22N3O2+ — CID 7027118
2-(4-methoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)acetamide (PubChem CID 7027118) has the molecular formula C14H22N3O2+ and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 7027118 |
| Molecular Formula | C14H22N3O2+ |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)acetamide |
| SMILES | COc1ccc(CC(=O)NN2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C14H21N3O2/c1-16-7-9-17(10-8-16)15-14(18)11-12-3-5-13(19-2)6-4-12/h3-6H,7-11H2,1-2H3,(H,15,18)/p+1 |
| InChIKey | FSMOQJAQNQQQBX-UHFFFAOYSA-O |
| XLogP | -0.90 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |