C16H26N3O4+ — CID 9075264
N-(4-methylpiperazin-4-ium-1-yl)-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 9075264) has the molecular formula C16H26N3O4+ and a molecular weight of 324.40 g/mol. Its IUPAC name is N-(4-methylpiperazin-4-ium-1-yl)-2-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | N-(4-methylpiperazin-4-ium-1-yl)-2-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9075264 |
| Molecular Formula | C16H26N3O4+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | N-(4-methylpiperazin-4-ium-1-yl)-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NN2CC[NH+](C)CC2)c(OC)c1OC |
| InChI | InChI=1S/C16H25N3O4/c1-18-7-9-19(10-8-18)17-14(20)11-12-5-6-13(21-2)16(23-4)15(12)22-3/h5-6H,7-11H2,1-4H3,(H,17,20)/p+1 |
| InChIKey | FHTWJPBVSQRVIX-UHFFFAOYSA-O |
| XLogP | -0.88 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |