C20H27N3O6 — CID 24545817
N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 24545817) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24545817 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NN2C(=O)NC3(CCC(C)CC3)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C20H27N3O6/c1-12-7-9-20(10-8-12)18(25)23(19(26)21-20)22-15(24)11-13-5-6-14(27-2)17(29-4)16(13)28-3/h5-6,12H,7-11H2,1-4H3,(H,21,26)(H,22,24) |
| InChIKey | ZWAHGRRCKOFJJB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|