C18H24N4O4 — CID 27056892
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methoxy-5-methylanilino)acetamide (PubChem CID 27056892) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methoxy-5-methylanilino)acetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methoxy-5-methylanilino)acetamide |
|---|---|
| PubChem CID | 27056892 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methoxy-5-methylanilino)acetamide |
| SMILES | COc1ccc(C)cc1NCC(=O)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C18H24N4O4/c1-12-6-7-14(26-2)13(10-12)19-11-15(23)21-22-16(24)18(20-17(22)25)8-4-3-5-9-18/h6-7,10,19H,3-5,8-9,11H2,1-2H3,(H,20,25)(H,21,23) |
| InChIKey | LROHHLQHHFFUEF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|