C17H20N4O7 — CID 24557174
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methoxy-5-nitrophenoxy)acetamide (PubChem CID 24557174) has the molecular formula C17H20N4O7 and a molecular weight of 392.37 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methoxy-5-nitrophenoxy)acetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methoxy-5-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 24557174 |
| Molecular Formula | C17H20N4O7 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methoxy-5-nitrophenoxy)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCC(=O)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C17H20N4O7/c1-27-12-6-5-11(21(25)26)9-13(12)28-10-14(22)19-20-15(23)17(18-16(20)24)7-3-2-4-8-17/h5-6,9H,2-4,7-8,10H2,1H3,(H,18,24)(H,19,22) |
| InChIKey | RWJJLNUQRLDLCN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|