C20H27N3O5 — CID 18268474
4-butoxy-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-methoxybenzamide (PubChem CID 18268474) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-butoxy-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-methoxybenzamide.
| Compound Name | 4-butoxy-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 18268474 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-butoxy-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-methoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)NN2C(=O)NC3(CCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C20H27N3O5/c1-3-4-12-28-15-9-8-14(13-16(15)27-2)17(24)22-23-18(25)20(21-19(23)26)10-6-5-7-11-20/h8-9,13H,3-7,10-12H2,1-2H3,(H,21,26)(H,22,24) |
| InChIKey | CNNJKQXNRRNLGG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|