C18H23N3O6 — CID 8873673
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3,4,5-trimethoxybenzamide (PubChem CID 8873673) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 8873673 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NN2C(=O)NC3(CCCCC3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H23N3O6/c1-25-12-9-11(10-13(26-2)14(12)27-3)15(22)20-21-16(23)18(19-17(21)24)7-5-4-6-8-18/h9-10H,4-8H2,1-3H3,(H,19,24)(H,20,22) |
| InChIKey | VOGNTSQRORASIL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|