C24H26N4O6 — CID 27532971
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-4-[2-(3-methoxyanilino)-2-oxoethoxy]benzamide (PubChem CID 27532971) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-4-[2-(3-methoxyanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-4-[2-(3-methoxyanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 27532971 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-4-[2-(3-methoxyanilino)-2-oxoethoxy]benzamide |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)NN3C(=O)NC4(CCCCC4)C3=O)cc2)c1 |
| InChI | InChI=1S/C24H26N4O6/c1-33-19-7-5-6-17(14-19)25-20(29)15-34-18-10-8-16(9-11-18)21(30)27-28-22(31)24(26-23(28)32)12-3-2-4-13-24/h5-11,14H,2-4,12-13,15H2,1H3,(H,25,29)(H,26,32)(H,27,30) |
| InChIKey | CVMYAEKWVTVTBG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|