C27H35N3O4 — CID 55987318
2-[4-[4-(cyclohexylmethyl)piperazine-1-carbonyl]phenoxy]-N-(3-methoxyphenyl)acetamide (PubChem CID 55987318) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is 2-[4-[4-(cyclohexylmethyl)piperazine-1-carbonyl]phenoxy]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[4-[4-(cyclohexylmethyl)piperazine-1-carbonyl]phenoxy]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55987318 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 2-[4-[4-(cyclohexylmethyl)piperazine-1-carbonyl]phenoxy]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)N3CCN(CC4CCCCC4)CC3)cc2)c1 |
| InChI | InChI=1S/C27H35N3O4/c1-33-25-9-5-8-23(18-25)28-26(31)20-34-24-12-10-22(11-13-24)27(32)30-16-14-29(15-17-30)19-21-6-3-2-4-7-21/h5,8-13,18,21H,2-4,6-7,14-17,19-20H2,1H3,(H,28,31) |
| InChIKey | RMKLBBXNIVGEHM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |