C25H33N3O4 — CID 154775568
4-[2-(3-methoxyanilino)-2-oxoethoxy]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 154775568) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-[2-(3-methoxyanilino)-2-oxoethoxy]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 4-[2-(3-methoxyanilino)-2-oxoethoxy]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 154775568 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 4-[2-(3-methoxyanilino)-2-oxoethoxy]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)NCCCN3CCC(C)CC3)cc2)c1 |
| InChI | InChI=1S/C25H33N3O4/c1-19-11-15-28(16-12-19)14-4-13-26-25(30)20-7-9-22(10-8-20)32-18-24(29)27-21-5-3-6-23(17-21)31-2/h3,5-10,17,19H,4,11-16,18H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | CWKLYXIRYHYWMA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|