C27H37N3O3 — CID 118462134
4-(3-methoxyphenoxy)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]benzamide (PubChem CID 118462134) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 4-(3-methoxyphenoxy)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 4-(3-methoxyphenoxy)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 118462134 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 4-(3-methoxyphenoxy)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]benzamide |
| SMILES | COc1cccc(Oc2ccc(C(=O)NCCCN3CCC(N4CCCCC4)CC3)cc2)c1 |
| InChI | InChI=1S/C27H37N3O3/c1-32-25-7-5-8-26(21-25)33-24-11-9-22(10-12-24)27(31)28-15-6-16-29-19-13-23(14-20-29)30-17-3-2-4-18-30/h5,7-12,21,23H,2-4,6,13-20H2,1H3,(H,28,31) |
| InChIKey | MZXUWIMCRNDWCW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|