C21H24F2N2O2 — CID 58945403
3-(3,4-difluorophenoxy)-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 58945403) has the molecular formula C21H24F2N2O2 and a molecular weight of 374.43 g/mol. Its IUPAC name is 3-(3,4-difluorophenoxy)-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 3-(3,4-difluorophenoxy)-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 58945403 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-(3,4-difluorophenoxy)-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCCCC1)c1cccc(Oc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C21H24F2N2O2/c22-19-9-8-18(15-20(19)23)27-17-7-4-6-16(14-17)21(26)24-10-5-13-25-11-2-1-3-12-25/h4,6-9,14-15H,1-3,5,10-13H2,(H,24,26) |
| InChIKey | NGHJEOVUNLVRIJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|