C23H27N3O6 — CID 35508706
ethyl 4-[4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoyl]piperazine-1-carboxylate (PubChem CID 35508706) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is ethyl 4-[4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 35508706 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | ethyl 4-[4-[2-(3-methoxyanilino)-2-oxoethoxy]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(OCC(=O)Nc3cccc(OC)c3)cc2)CC1 |
| InChI | InChI=1S/C23H27N3O6/c1-3-31-23(29)26-13-11-25(12-14-26)22(28)17-7-9-19(10-8-17)32-16-21(27)24-18-5-4-6-20(15-18)30-2/h4-10,15H,3,11-14,16H2,1-2H3,(H,24,27) |
| InChIKey | UZGSCGGVKFGPEP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |