C17H25N3O4 — CID 109003643
ethyl 4-[[2-(3-methoxyanilino)-2-oxoethyl]amino]piperidine-1-carboxylate (PubChem CID 109003643) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethyl 4-[[2-(3-methoxyanilino)-2-oxoethyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(3-methoxyanilino)-2-oxoethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109003643 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | ethyl 4-[[2-(3-methoxyanilino)-2-oxoethyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCC(=O)Nc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-3-24-17(22)20-9-7-13(8-10-20)18-12-16(21)19-14-5-4-6-15(11-14)23-2/h4-6,11,13,18H,3,7-10,12H2,1-2H3,(H,19,21) |
| InChIKey | WRFRKFYUAWWCGU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |