C19H22N6O4S2 — CID 16518875
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[5-(3-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 16518875) has the molecular formula C19H22N6O4S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[5-(3-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[5-(3-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16518875 |
| Molecular Formula | C19H22N6O4S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[[5-(3-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1cccc(Nc2nnc(SCC(=O)NN3C(=O)NC4(CCCCC4)C3=O)s2)c1 |
| InChI | InChI=1S/C19H22N6O4S2/c1-29-13-7-5-6-12(10-13)20-16-22-23-18(31-16)30-11-14(26)24-25-15(27)19(21-17(25)28)8-3-2-4-9-19/h5-7,10H,2-4,8-9,11H2,1H3,(H,20,22)(H,21,28)(H,24,26) |
| InChIKey | JBQPHYJKOYZQBB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|