C21H26N6O3S2 — CID 16531238
2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 16531238) has the molecular formula C21H26N6O3S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 16531238 |
| Molecular Formula | C21H26N6O3S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | Cc1cccc(Nc2nnc(SCC(=O)NN3C(=O)NC4(CCC(C)CC4)C3=O)s2)c1C |
| InChI | InChI=1S/C21H26N6O3S2/c1-12-7-9-21(10-8-12)17(29)27(19(30)23-21)26-16(28)11-31-20-25-24-18(32-20)22-15-6-4-5-13(2)14(15)3/h4-6,12H,7-11H2,1-3H3,(H,22,24)(H,23,30)(H,26,28) |
| InChIKey | KOSUQWNTQRYKDJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|