C16H20N4O4 — CID 24545842
6-methoxy-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)pyridine-3-carboxamide (PubChem CID 24545842) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 6-methoxy-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)pyridine-3-carboxamide.
| Compound Name | 6-methoxy-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24545842 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 6-methoxy-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NN2C(=O)NC3(CCC(C)CC3)C2=O)cn1 |
| InChI | InChI=1S/C16H20N4O4/c1-10-5-7-16(8-6-10)14(22)20(15(23)18-16)19-13(21)11-3-4-12(24-2)17-9-11/h3-4,9-10H,5-8H2,1-2H3,(H,18,23)(H,19,21) |
| InChIKey | VILMJIBZVZUXAV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|