C16H20N4O4 — CID 24545818
4-acetyl-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1H-pyrrole-2-carboxamide (PubChem CID 24545818) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-acetyl-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 24545818 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-acetyl-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c[nH]c(C(=O)NN2C(=O)NC3(CCC(C)CC3)C2=O)c1 |
| InChI | InChI=1S/C16H20N4O4/c1-9-3-5-16(6-4-9)14(23)20(15(24)18-16)19-13(22)12-7-11(8-17-12)10(2)21/h7-9,17H,3-6H2,1-2H3,(H,18,24)(H,19,22) |
| InChIKey | OZSPMWLZVQMOFK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|