C12H17N3O2 — CID 9083903
4-acetyl-N-piperidin-1-yl-1H-pyrrole-2-carboxamide (PubChem CID 9083903) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-acetyl-N-piperidin-1-yl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-piperidin-1-yl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 9083903 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 4-acetyl-N-piperidin-1-yl-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c[nH]c(C(=O)NN2CCCCC2)c1 |
| InChI | InChI=1S/C12H17N3O2/c1-9(16)10-7-11(13-8-10)12(17)14-15-5-3-2-4-6-15/h7-8,13H,2-6H2,1H3,(H,14,17) |
| InChIKey | UTPRQZKHEUHONM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |