C19H23N5O5 — CID 16960910
4-(cyclopropylamino)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-nitrobenzamide (PubChem CID 16960910) has the molecular formula C19H23N5O5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 16960910 |
| Molecular Formula | C19H23N5O5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-(cyclopropylamino)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-nitrobenzamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)c1ccc(NC3CC3)c([N+](=O)[O-])c1)C2=O |
| InChI | InChI=1S/C19H23N5O5/c1-11-6-8-19(9-7-11)17(26)23(18(27)21-19)22-16(25)12-2-5-14(20-13-3-4-13)15(10-12)24(28)29/h2,5,10-11,13,20H,3-4,6-9H2,1H3,(H,21,27)(H,22,25) |
| InChIKey | LTKXSZXBCLYBMC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|