C19H26N4O4 — CID 34000828
N-cyclopropyl-4-[[1-(2-methylpropanoyl)piperidin-4-yl]amino]-3-nitrobenzamide (PubChem CID 34000828) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-cyclopropyl-4-[[1-(2-methylpropanoyl)piperidin-4-yl]amino]-3-nitrobenzamide.
| Compound Name | N-cyclopropyl-4-[[1-(2-methylpropanoyl)piperidin-4-yl]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 34000828 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-cyclopropyl-4-[[1-(2-methylpropanoyl)piperidin-4-yl]amino]-3-nitrobenzamide |
| SMILES | CC(C)C(=O)N1CCC(Nc2ccc(C(=O)NC3CC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H26N4O4/c1-12(2)19(25)22-9-7-15(8-10-22)20-16-6-3-13(11-17(16)23(26)27)18(24)21-14-4-5-14/h3,6,11-12,14-15,20H,4-5,7-10H2,1-2H3,(H,21,24) |
| InChIKey | IHWWZHBDXJGTSM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|