C22H28N4O7 — CID 16960079
[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 4-tert-butyl-3-nitrobenzoate (PubChem CID 16960079) has the molecular formula C22H28N4O7 and a molecular weight of 460.49 g/mol. Its IUPAC name is [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 4-tert-butyl-3-nitrobenzoate.
| Compound Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 4-tert-butyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 16960079 |
| Molecular Formula | C22H28N4O7 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 4-tert-butyl-3-nitrobenzoate |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)COC(=O)c1ccc(C(C)(C)C)c([N+](=O)[O-])c1)C2=O |
| InChI | InChI=1S/C22H28N4O7/c1-13-7-9-22(10-8-13)19(29)25(20(30)23-22)24-17(27)12-33-18(28)14-5-6-15(21(2,3)4)16(11-14)26(31)32/h5-6,11,13H,7-10,12H2,1-4H3,(H,23,30)(H,24,27) |
| InChIKey | QUBBKCFFPMXOKK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|