C18H23N5O4 — CID 17476930
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 17476930) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 17476930 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(NN1C(=O)NC2(CCCCC2)C1=O)c1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C18H23N5O4/c24-15(13-4-5-14(19-12-13)22-8-10-27-11-9-22)21-23-16(25)18(20-17(23)26)6-2-1-3-7-18/h4-5,12H,1-3,6-11H2,(H,20,26)(H,21,24) |
| InChIKey | DWHLEHOATQNXLD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|