C16H16IN3O2 — CID 17489612
N-(4-iodophenyl)-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 17489612) has the molecular formula C16H16IN3O2 and a molecular weight of 409.23 g/mol. Its IUPAC name is N-(4-iodophenyl)-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-(4-iodophenyl)-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 17489612 |
| Molecular Formula | C16H16IN3O2 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-(4-iodophenyl)-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C16H16IN3O2/c17-13-2-4-14(5-3-13)19-16(21)12-1-6-15(18-11-12)20-7-9-22-10-8-20/h1-6,11H,7-10H2,(H,19,21) |
| InChIKey | ANDPBTLSDCDTLD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|