C25H23N3O5 — CID 24600768
[2-(4-benzamidophenyl)-2-oxoethyl] 6-morpholin-4-ylpyridine-3-carboxylate (PubChem CID 24600768) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] 6-morpholin-4-ylpyridine-3-carboxylate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] 6-morpholin-4-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 24600768 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] 6-morpholin-4-ylpyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(N2CCOCC2)nc1)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O5/c29-22(18-6-9-21(10-7-18)27-24(30)19-4-2-1-3-5-19)17-33-25(31)20-8-11-23(26-16-20)28-12-14-32-15-13-28/h1-11,16H,12-15,17H2,(H,27,30) |
| InChIKey | KXBYIJNXRPGMPC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |