C20H20N4O4 — CID 18140140
4-(2,5-dioxopyrrolidin-1-yl)-N-(6-morpholin-4-yl-3-pyridinyl)benzamide (PubChem CID 18140140) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-(6-morpholin-4-yl-3-pyridinyl)benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(6-morpholin-4-yl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 18140140 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(6-morpholin-4-yl-3-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)nc1)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C20H20N4O4/c25-18-7-8-19(26)24(18)16-4-1-14(2-5-16)20(27)22-15-3-6-17(21-13-15)23-9-11-28-12-10-23/h1-6,13H,7-12H2,(H,22,27) |
| InChIKey | GYDNFIUYVJHOEM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|