C17H17FN4O3 — CID 46697479
N'-(4-fluorobenzoyl)-6-morpholin-4-ylpyridine-3-carbohydrazide (PubChem CID 46697479) has the molecular formula C17H17FN4O3 and a molecular weight of 344.35 g/mol. Its IUPAC name is N'-(4-fluorobenzoyl)-6-morpholin-4-ylpyridine-3-carbohydrazide.
| Compound Name | N'-(4-fluorobenzoyl)-6-morpholin-4-ylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 46697479 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N'-(4-fluorobenzoyl)-6-morpholin-4-ylpyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(N2CCOCC2)nc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN4O3/c18-14-4-1-12(2-5-14)16(23)20-21-17(24)13-3-6-15(19-11-13)22-7-9-25-10-8-22/h1-6,11H,7-10H2,(H,20,23)(H,21,24) |
| InChIKey | QJHBSXBMQCONEE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|