C19H21FN4O3 — CID 17469565
4-fluoro-N-[2-[(6-morpholin-4-yl-3-pyridinyl)methylamino]-2-oxoethyl]benzamide (PubChem CID 17469565) has the molecular formula C19H21FN4O3 and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-fluoro-N-[2-[(6-morpholin-4-yl-3-pyridinyl)methylamino]-2-oxoethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[(6-morpholin-4-yl-3-pyridinyl)methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17469565 |
| Molecular Formula | C19H21FN4O3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-fluoro-N-[2-[(6-morpholin-4-yl-3-pyridinyl)methylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)NCc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C19H21FN4O3/c20-16-4-2-15(3-5-16)19(26)23-13-18(25)22-12-14-1-6-17(21-11-14)24-7-9-27-10-8-24/h1-6,11H,7-10,12-13H2,(H,22,25)(H,23,26) |
| InChIKey | GVCHRQRMWRLTGM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |