C18H24Cl2N4O2 — CID 119839439
2-(4-aminophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]acetamide;dihydrochloride (PubChem CID 119839439) has the molecular formula C18H24Cl2N4O2 and a molecular weight of 399.32 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119839439 |
| Molecular Formula | C18H24Cl2N4O2 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-(4-aminophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)NCc2ccc(N3CCOCC3)nc2)cc1 |
| InChI | InChI=1S/C18H22N4O2.2ClH/c19-16-4-1-14(2-5-16)11-18(23)21-13-15-3-6-17(20-12-15)22-7-9-24-10-8-22;;/h1-6,12H,7-11,13,19H2,(H,21,23);2*1H |
| InChIKey | CCLRDMCRKHUQAU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|