C25H25ClN4O4 — CID 24606049
N'-[4-[(4-chloro-3-methylphenoxy)methyl]benzoyl]-6-morpholin-4-ylpyridine-3-carbohydrazide (PubChem CID 24606049) has the molecular formula C25H25ClN4O4 and a molecular weight of 480.95 g/mol. Its IUPAC name is N'-[4-[(4-chloro-3-methylphenoxy)methyl]benzoyl]-6-morpholin-4-ylpyridine-3-carbohydrazide.
| Compound Name | N'-[4-[(4-chloro-3-methylphenoxy)methyl]benzoyl]-6-morpholin-4-ylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24606049 |
| Molecular Formula | C25H25ClN4O4 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N'-[4-[(4-chloro-3-methylphenoxy)methyl]benzoyl]-6-morpholin-4-ylpyridine-3-carbohydrazide |
| SMILES | Cc1cc(OCc2ccc(C(=O)NNC(=O)c3ccc(N4CCOCC4)nc3)cc2)ccc1Cl |
| InChI | InChI=1S/C25H25ClN4O4/c1-17-14-21(7-8-22(17)26)34-16-18-2-4-19(5-3-18)24(31)28-29-25(32)20-6-9-23(27-15-20)30-10-12-33-13-11-30/h2-9,14-15H,10-13,16H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | YRZGDGJPKAHCNQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|