C29H32ClN3O2 — CID 4843166
N-[1-[4-(azepan-1-yl)phenyl]ethylideneamino]-4-[(4-chloro-3-methylphenoxy)methyl]benzamide (PubChem CID 4843166) has the molecular formula C29H32ClN3O2 and a molecular weight of 490.05 g/mol. Its IUPAC name is N-[1-[4-(azepan-1-yl)phenyl]ethylideneamino]-4-[(4-chloro-3-methylphenoxy)methyl]benzamide.
| Compound Name | N-[1-[4-(azepan-1-yl)phenyl]ethylideneamino]-4-[(4-chloro-3-methylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 4843166 |
| Molecular Formula | C29H32ClN3O2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[1-[4-(azepan-1-yl)phenyl]ethylideneamino]-4-[(4-chloro-3-methylphenoxy)methyl]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(COc2ccc(Cl)c(C)c2)cc1)c1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C29H32ClN3O2/c1-21-19-27(15-16-28(21)30)35-20-23-7-9-25(10-8-23)29(34)32-31-22(2)24-11-13-26(14-12-24)33-17-5-3-4-6-18-33/h7-16,19H,3-6,17-18,20H2,1-2H3,(H,32,34) |
| InChIKey | SFLOZDUTDJHPGD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|