C18H16ClF3N2O2 — CID 19586029
4-[(4-chloro-3-methylphenoxy)methyl]-N-[(E)-3,3,3-trifluoropropylideneamino]benzamide (PubChem CID 19586029) has the molecular formula C18H16ClF3N2O2 and a molecular weight of 384.79 g/mol. Its IUPAC name is 4-[(4-chloro-3-methylphenoxy)methyl]-N-[(E)-3,3,3-trifluoropropylideneamino]benzamide.
| Compound Name | 4-[(4-chloro-3-methylphenoxy)methyl]-N-[(E)-3,3,3-trifluoropropylideneamino]benzamide |
|---|---|
| PubChem CID | 19586029 |
| Molecular Formula | C18H16ClF3N2O2 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-[(4-chloro-3-methylphenoxy)methyl]-N-[(E)-3,3,3-trifluoropropylideneamino]benzamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)N/N=C/CC(F)(F)F)cc2)ccc1Cl |
| InChI | InChI=1S/C18H16ClF3N2O2/c1-12-10-15(6-7-16(12)19)26-11-13-2-4-14(5-3-13)17(25)24-23-9-8-18(20,21)22/h2-7,9-10H,8,11H2,1H3,(H,24,25)/b23-9+ |
| InChIKey | DWYDCQKNKGXORC-NUGSKGIGSA-N |
| XLogP | 4.90 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|