C27H22ClN3O2 — CID 6263348
4-[(4-chloro-3-methylphenoxy)methyl]-N-[(Z)-[phenyl(pyridin-2-yl)methylidene]amino]benzamide (PubChem CID 6263348) has the molecular formula C27H22ClN3O2 and a molecular weight of 455.95 g/mol. Its IUPAC name is 4-[(4-chloro-3-methylphenoxy)methyl]-N-[(Z)-[phenyl(pyridin-2-yl)methylidene]amino]benzamide.
| Compound Name | 4-[(4-chloro-3-methylphenoxy)methyl]-N-[(Z)-[phenyl(pyridin-2-yl)methylidene]amino]benzamide |
|---|---|
| PubChem CID | 6263348 |
| Molecular Formula | C27H22ClN3O2 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-[(4-chloro-3-methylphenoxy)methyl]-N-[(Z)-[phenyl(pyridin-2-yl)methylidene]amino]benzamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)N/N=C(/c3ccccc3)c3ccccn3)cc2)ccc1Cl |
| InChI | InChI=1S/C27H22ClN3O2/c1-19-17-23(14-15-24(19)28)33-18-20-10-12-22(13-11-20)27(32)31-30-26(21-7-3-2-4-8-21)25-9-5-6-16-29-25/h2-17H,18H2,1H3,(H,31,32)/b30-26- |
| InChIKey | UELYTWZMVRQBKZ-BXVZCJGGSA-N |
| XLogP | 5.80 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|