C21H24N4O4S — CID 46407840
2-(4-ethoxyphenyl)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 46407840) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46407840 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(=O)NN3C(=O)NC4(CCC(C)CC4)C3=O)cs2)cc1 |
| InChI | InChI=1S/C21H24N4O4S/c1-3-29-15-6-4-14(5-7-15)18-22-16(12-30-18)17(26)24-25-19(27)21(23-20(25)28)10-8-13(2)9-11-21/h4-7,12-13H,3,8-11H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | SWIYMJFZWPREOP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|