C20H30N6O5S — CID 24533737
2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 24533737) has the molecular formula C20H30N6O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 24533737 |
| Molecular Formula | C20H30N6O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(C)C)cc1NCC(=O)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C20H30N6O5S/c1-4-21-15-9-8-14(32(30,31)25(2)3)12-16(15)22-13-17(27)24-26-18(28)20(23-19(26)29)10-6-5-7-11-20/h8-9,12,21-22H,4-7,10-11,13H2,1-3H3,(H,23,29)(H,24,27) |
| InChIKey | HEVMBWLPLVFGBC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|