C17H21N5O5 — CID 27056903
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methyl-3-nitroanilino)acetamide (PubChem CID 27056903) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methyl-3-nitroanilino)acetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methyl-3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 27056903 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-methyl-3-nitroanilino)acetamide |
| SMILES | Cc1c(NCC(=O)NN2C(=O)NC3(CCCCC3)C2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O5/c1-11-12(6-5-7-13(11)22(26)27)18-10-14(23)20-21-15(24)17(19-16(21)25)8-3-2-4-9-17/h5-7,18H,2-4,8-10H2,1H3,(H,19,25)(H,20,23) |
| InChIKey | QIEMWXURAKRLKY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|