C15H23N3O4 — CID 9204696
2,3,4-trimethoxy-N-(4-methylpiperazin-1-yl)benzamide (PubChem CID 9204696) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 2,3,4-trimethoxy-N-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 9204696 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2,3,4-trimethoxy-N-(4-methylpiperazin-1-yl)benzamide |
| SMILES | COc1ccc(C(=O)NN2CCN(C)CC2)c(OC)c1OC |
| InChI | InChI=1S/C15H23N3O4/c1-17-7-9-18(10-8-17)16-15(19)11-5-6-12(20-2)14(22-4)13(11)21-3/h5-6H,7-10H2,1-4H3,(H,16,19) |
| InChIKey | LNFIZBQBPZDXFA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |