C15H20Cl2N4O3 — CID 70574836
5-chloro-4-[(2-chloroacetyl)amino]-2-methoxy-N-(4-methylpiperazin-1-yl)benzamide (PubChem CID 70574836) has the molecular formula C15H20Cl2N4O3 and a molecular weight of 375.26 g/mol. Its IUPAC name is 5-chloro-4-[(2-chloroacetyl)amino]-2-methoxy-N-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 5-chloro-4-[(2-chloroacetyl)amino]-2-methoxy-N-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 70574836 |
| Molecular Formula | C15H20Cl2N4O3 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-chloro-4-[(2-chloroacetyl)amino]-2-methoxy-N-(4-methylpiperazin-1-yl)benzamide |
| SMILES | COc1cc(NC(=O)CCl)c(Cl)cc1C(=O)NN1CCN(C)CC1 |
| InChI | InChI=1S/C15H20Cl2N4O3/c1-20-3-5-21(6-4-20)19-15(23)10-7-11(17)12(8-13(10)24-2)18-14(22)9-16/h7-8H,3-6,9H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | LORNIDHEWRUAPI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|