C18H25N3O4 — CID 153408978
2,3,4-trimethoxy-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]benzamide (PubChem CID 153408978) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 153408978 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2,3,4-trimethoxy-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]benzamide |
| SMILES | COc1ccc(C(=O)NN=C2CC3CCC(C2)N3C)c(OC)c1OC |
| InChI | InChI=1S/C18H25N3O4/c1-21-12-5-6-13(21)10-11(9-12)19-20-18(22)14-7-8-15(23-2)17(25-4)16(14)24-3/h7-8,12-13H,5-6,9-10H2,1-4H3,(H,20,22) |
| InChIKey | ISBGKKBLVFYVOZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|