C9H16N4O — CID 779400
[[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]amino]urea (PubChem CID 779400) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is [[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]amino]urea.
| Compound Name | [[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]amino]urea |
|---|---|
| PubChem CID | 779400 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]amino]urea |
| SMILES | CN1[C@@H]2CC[C@H]1C/C(=N\NC(N)=O)C2 |
| InChI | InChI=1S/C9H16N4O/c1-13-7-2-3-8(13)5-6(4-7)11-12-9(10)14/h7-8H,2-5H2,1H3,(H3,10,12,14)/b11-6-/t7-,8+/m1/s1 |
| InChIKey | VDGKTGWSAJCCDP-SEIKAGIBSA-N |
| XLogP | 0.27 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|