C9H17N5 — CID 65211894
2-[(8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]guanidine (PubChem CID 65211894) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-[(8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]guanidine.
| Compound Name | 2-[(8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]guanidine |
|---|---|
| PubChem CID | 65211894 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 2-[(8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene)amino]guanidine |
| SMILES | CN1C2CCC1CC(=NN=C(N)N)C2 |
| InChI | InChI=1S/C9H17N5/c1-14-7-2-3-8(14)5-6(4-7)12-13-9(10)11/h7-8H,2-5H2,1H3,(H4,10,11,13) |
| InChIKey | BKFHDPAYOQNTIX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|