C15H20ClNO4 — CID 106443653
N-(2-chlorocyclopentyl)-2,3,4-trimethoxybenzamide (PubChem CID 106443653) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is N-(2-chlorocyclopentyl)-2,3,4-trimethoxybenzamide.
| Compound Name | N-(2-chlorocyclopentyl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 106443653 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-(2-chlorocyclopentyl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCCC2Cl)c(OC)c1OC |
| InChI | InChI=1S/C15H20ClNO4/c1-19-12-8-7-9(13(20-2)14(12)21-3)15(18)17-11-6-4-5-10(11)16/h7-8,10-11H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | PYHGOKJKAZCFSC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|